C24H33ClN4O — CID 111319496
1-[1-(2-chlorophenyl)ethyl]-3-ethyl-2-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]guanidine (PubChem CID 111319496) has the molecular formula C24H33ClN4O and a molecular weight of 429.01 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)ethyl]-3-ethyl-2-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]guanidine.
| Compound Name | 1-[1-(2-chlorophenyl)ethyl]-3-ethyl-2-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111319496 |
| Molecular Formula | C24H33ClN4O |
| Molecular Weight | 429.01 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 1-[1-(2-chlorophenyl)ethyl]-3-ethyl-2-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCC(CO)CC2)cc1)NC(C)c1ccccc1Cl |
| InChI | InChI=1S/C24H33ClN4O/c1-3-26-24(28-18(2)22-6-4-5-7-23(22)25)27-16-19-8-10-21(11-9-19)29-14-12-20(17-30)13-15-29/h4-11,18,20,30H,3,12-17H2,1-2H3,(H2,26,27,28) |
| InChIKey | GGRIDFZGWXHCLT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.01 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|