C22H36IN7 — CID 111320201
1-ethyl-3-(2-methyl-2-piperidin-1-ylpropyl)-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111320201) has the molecular formula C22H36IN7 and a molecular weight of 525.48 g/mol. Its IUPAC name is 1-ethyl-3-(2-methyl-2-piperidin-1-ylpropyl)-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-methyl-2-piperidin-1-ylpropyl)-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111320201 |
| Molecular Formula | C22H36IN7 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 1-ethyl-3-(2-methyl-2-piperidin-1-ylpropyl)-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2cncn2)c1)NCC(C)(C)N1CCCCC1.I |
| InChI | InChI=1S/C22H35N7.HI/c1-4-24-21(26-16-22(2,3)28-11-6-5-7-12-28)25-14-19-9-8-10-20(13-19)15-29-18-23-17-27-29;/h8-10,13,17-18H,4-7,11-12,14-16H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | RQZPZIAGZQYCJF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|