C23H37IN6 — CID 111320203
1-ethyl-2-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111320203) has the molecular formula C23H37IN6 and a molecular weight of 524.50 g/mol. Its IUPAC name is 1-ethyl-2-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111320203 |
| Molecular Formula | C23H37IN6 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 1-ethyl-2-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2ccnc2)c1)NCC(C)(C)N1CCCCC1.I |
| InChI | InChI=1S/C23H36N6.HI/c1-4-25-22(27-18-23(2,3)29-12-6-5-7-13-29)26-16-20-9-8-10-21(15-20)17-28-14-11-24-19-28;/h8-11,14-15,19H,4-7,12-13,16-18H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | KXCBNEMYNKWRBI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|