C16H31N7 — CID 111320580
1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine (PubChem CID 111320580) has the molecular formula C16H31N7 and a molecular weight of 321.47 g/mol. Its IUPAC name is 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine.
| Compound Name | 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111320580 |
| Molecular Formula | C16H31N7 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.26 |
| IUPAC Name | 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine |
| SMILES | CCn1cnnc1CN/C(=N\C)NCC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C16H31N7/c1-5-22-13-20-21-14(22)11-18-15(17-4)19-12-16(2,3)23-9-7-6-8-10-23/h13H,5-12H2,1-4H3,(H2,17,18,19) |
| InChIKey | MOPFDTOHQBPVQB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|