C13H22INO3 — CID 11132311
(2R)-1-[(2R,5R)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-2-iodopent-4-en-1-one (PubChem CID 11132311) has the molecular formula C13H22INO3 and a molecular weight of 367.23 g/mol. Its IUPAC name is (2R)-1-[(2R,5R)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-2-iodopent-4-en-1-one.
| Compound Name | (2R)-1-[(2R,5R)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-2-iodopent-4-en-1-one |
|---|---|
| PubChem CID | 11132311 |
| Molecular Formula | C13H22INO3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | (2R)-1-[(2R,5R)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]-2-iodopent-4-en-1-one |
| SMILES | C=CC[C@@H](I)C(=O)N1[C@@H](COC)CC[C@@H]1COC |
| InChI | InChI=1S/C13H22INO3/c1-4-5-12(14)13(16)15-10(8-17-2)6-7-11(15)9-18-3/h4,10-12H,1,5-9H2,2-3H3/t10-,11-,12-/m1/s1 |
| InChIKey | DFKRVCZRNNXLIV-IJLUTSLNSA-N |
| XLogP | 2.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|