C21H32N6O2 — CID 111328692
ethyl 4-[[N'-[3-(1H-benzimidazol-2-yl)propyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111328692) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is ethyl 4-[[N'-[3-(1H-benzimidazol-2-yl)propyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[3-(1H-benzimidazol-2-yl)propyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111328692 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | ethyl 4-[[N'-[3-(1H-benzimidazol-2-yl)propyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CCCc1nc2ccccc2[nH]1)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C21H32N6O2/c1-3-22-20(24-16-11-14-27(15-12-16)21(28)29-4-2)23-13-7-10-19-25-17-8-5-6-9-18(17)26-19/h5-6,8-9,16H,3-4,7,10-15H2,1-2H3,(H,25,26)(H2,22,23,24) |
| InChIKey | STPZPSRKIDEPOM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|