C26H36N6 — CID 109459442
2-[3-(1H-benzimidazol-2-yl)propyl]-1-(1-benzyl-2-methylpiperidin-4-yl)-3-ethylguanidine (PubChem CID 109459442) has the molecular formula C26H36N6 and a molecular weight of 432.62 g/mol. Its IUPAC name is 2-[3-(1H-benzimidazol-2-yl)propyl]-1-(1-benzyl-2-methylpiperidin-4-yl)-3-ethylguanidine.
| Compound Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-(1-benzyl-2-methylpiperidin-4-yl)-3-ethylguanidine |
|---|---|
| PubChem CID | 109459442 |
| Molecular Formula | C26H36N6 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-(1-benzyl-2-methylpiperidin-4-yl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CCCc1nc2ccccc2[nH]1)NC1CCN(Cc2ccccc2)C(C)C1 |
| InChI | InChI=1S/C26H36N6/c1-3-27-26(28-16-9-14-25-30-23-12-7-8-13-24(23)31-25)29-22-15-17-32(20(2)18-22)19-21-10-5-4-6-11-21/h4-8,10-13,20,22H,3,9,14-19H2,1-2H3,(H,30,31)(H2,27,28,29) |
| InChIKey | NIROYVAOFBRLMR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|