C14H9Cl2FN2O4S — CID 11132929
4-chloro-2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-5-methylsulfonylpyridazin-3-one (PubChem CID 11132929) has the molecular formula C14H9Cl2FN2O4S and a molecular weight of 391.21 g/mol. Its IUPAC name is 4-chloro-2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-5-methylsulfonylpyridazin-3-one.
| Compound Name | 4-chloro-2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-5-methylsulfonylpyridazin-3-one |
|---|---|
| PubChem CID | 11132929 |
| Molecular Formula | C14H9Cl2FN2O4S |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 4-chloro-2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-5-methylsulfonylpyridazin-3-one |
| SMILES | C#CCOc1cc(-n2ncc(S(C)(=O)=O)c(Cl)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C14H9Cl2FN2O4S/c1-3-4-23-11-6-10(9(17)5-8(11)15)19-14(20)13(16)12(7-18-19)24(2,21)22/h1,5-7H,4H2,2H3 |
| InChIKey | RMPRJYKZZVYDRP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|