C14H9Cl2FN2O2S — CID 22000051
4-chloro-2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-5-methylsulfanylpyridazin-3-one (PubChem CID 22000051) has the molecular formula C14H9Cl2FN2O2S and a molecular weight of 359.21 g/mol. Its IUPAC name is 4-chloro-2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-5-methylsulfanylpyridazin-3-one.
| Compound Name | 4-chloro-2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-5-methylsulfanylpyridazin-3-one |
|---|---|
| PubChem CID | 22000051 |
| Molecular Formula | C14H9Cl2FN2O2S |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 4-chloro-2-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-5-methylsulfanylpyridazin-3-one |
| SMILES | C#CCOc1cc(-n2ncc(SC)c(Cl)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C14H9Cl2FN2O2S/c1-3-4-21-11-6-10(9(17)5-8(11)15)19-14(20)13(16)12(22-2)7-18-19/h1,5-7H,4H2,2H3 |
| InChIKey | CRPNUQCMGDCNLQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|