C18H32N6O2 — CID 111329712
ethyl 4-[[N-ethyl-N'-[3-(4-methylpyrazol-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111329712) has the molecular formula C18H32N6O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[3-(4-methylpyrazol-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-ethyl-N'-[3-(4-methylpyrazol-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111329712 |
| Molecular Formula | C18H32N6O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[3-(4-methylpyrazol-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CCCn1cc(C)cn1)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C18H32N6O2/c1-4-19-17(20-9-6-10-24-14-15(3)13-21-24)22-16-7-11-23(12-8-16)18(25)26-5-2/h13-14,16H,4-12H2,1-3H3,(H2,19,20,22) |
| InChIKey | OOMFLGOTJBOMPC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|