C21H41IN6O3 — CID 111329793
ethyl 4-[[N'-[3-[2-(dimethylcarbamoyl)pyrrolidin-1-yl]propyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111329793) has the molecular formula C21H41IN6O3 and a molecular weight of 552.50 g/mol. Its IUPAC name is ethyl 4-[[N'-[3-[2-(dimethylcarbamoyl)pyrrolidin-1-yl]propyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[3-[2-(dimethylcarbamoyl)pyrrolidin-1-yl]propyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111329793 |
| Molecular Formula | C21H41IN6O3 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | ethyl 4-[[N'-[3-[2-(dimethylcarbamoyl)pyrrolidin-1-yl]propyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCC1C(=O)N(C)C)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C21H40N6O3.HI/c1-5-22-20(24-17-10-15-27(16-11-17)21(29)30-6-2)23-12-8-14-26-13-7-9-18(26)19(28)25(3)4;/h17-18H,5-16H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | YDFIWHQPVBADMI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|