C17H36IN5O2 — CID 111237490
1-[3-[[ethylamino-(1-methoxypropan-2-ylamino)methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide (PubChem CID 111237490) has the molecular formula C17H36IN5O2 and a molecular weight of 469.41 g/mol. Its IUPAC name is 1-[3-[[ethylamino-(1-methoxypropan-2-ylamino)methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[ethylamino-(1-methoxypropan-2-ylamino)methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111237490 |
| Molecular Formula | C17H36IN5O2 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 1-[3-[[ethylamino-(1-methoxypropan-2-ylamino)methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCC1C(=O)N(C)C)NC(C)COC.I |
| InChI | InChI=1S/C17H35N5O2.HI/c1-6-18-17(20-14(2)13-24-5)19-10-8-12-22-11-7-9-15(22)16(23)21(3)4;/h14-15H,6-13H2,1-5H3,(H2,18,19,20);1H |
| InChIKey | VFERXZLSKDGETN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|