C26H38IN5O — CID 111330681
1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111330681) has the molecular formula C26H38IN5O and a molecular weight of 563.53 g/mol. Its IUPAC name is 1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111330681 |
| Molecular Formula | C26H38IN5O |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCC2=O)cc1)NCCN(CC)c1cccc(C)c1.I |
| InChI | InChI=1S/C26H37N5O.HI/c1-4-27-26(28-15-17-30(5-2)24-9-6-8-21(3)18-24)29-19-22-11-13-23(14-12-22)20-31-16-7-10-25(31)32;/h6,8-9,11-14,18H,4-5,7,10,15-17,19-20H2,1-3H3,(H2,27,28,29);1H |
| InChIKey | LQNMXGIZMDXDJQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|