C23H31IN4OS — CID 111372646
1-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111372646) has the molecular formula C23H31IN4OS and a molecular weight of 538.50 g/mol. Its IUPAC name is 1-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111372646 |
| Molecular Formula | C23H31IN4OS |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 1-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCC2=O)cc1)NCCSc1ccccc1.I |
| InChI | InChI=1S/C23H30N4OS.HI/c1-2-24-23(25-14-16-29-21-7-4-3-5-8-21)26-17-19-10-12-20(13-11-19)18-27-15-6-9-22(27)28;/h3-5,7-8,10-13H,2,6,9,14-18H2,1H3,(H2,24,25,26);1H |
| InChIKey | SCSDUVHJQSKDAU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|