C11H20N4O2S2 — CID 111331024
1-[2-(methanesulfonamido)ethyl]-2-methyl-3-(1-thiophen-2-ylethyl)guanidine (PubChem CID 111331024) has the molecular formula C11H20N4O2S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 1-[2-(methanesulfonamido)ethyl]-2-methyl-3-(1-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[2-(methanesulfonamido)ethyl]-2-methyl-3-(1-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111331024 |
| Molecular Formula | C11H20N4O2S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-[2-(methanesulfonamido)ethyl]-2-methyl-3-(1-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCNS(C)(=O)=O)NC(C)c1cccs1 |
| InChI | InChI=1S/C11H20N4O2S2/c1-9(10-5-4-8-18-10)15-11(12-2)13-6-7-14-19(3,16)17/h4-5,8-9,14H,6-7H2,1-3H3,(H2,12,13,15) |
| InChIKey | NRCFGJDCFXBPDU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|