C16H20F2IN3S — CID 111566702
1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-(1-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111566702) has the molecular formula C16H20F2IN3S and a molecular weight of 451.32 g/mol. Its IUPAC name is 1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-(1-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-(1-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111566702 |
| Molecular Formula | C16H20F2IN3S |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-(1-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cccc(F)c1F)NC(C)c1cccs1.I |
| InChI | InChI=1S/C16H19F2N3S.HI/c1-11(14-7-4-10-22-14)21-16(19-2)20-9-8-12-5-3-6-13(17)15(12)18;/h3-7,10-11H,8-9H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | QPYPRRWJFOLBCP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|