C16H9Cl3N2S2 — CID 11133121
2-chloro-4,6-bis[(4-chlorophenyl)sulfanyl]pyrimidine (PubChem CID 11133121) has the molecular formula C16H9Cl3N2S2 and a molecular weight of 399.76 g/mol. Its IUPAC name is 2-chloro-4,6-bis[(4-chlorophenyl)sulfanyl]pyrimidine.
| Compound Name | 2-chloro-4,6-bis[(4-chlorophenyl)sulfanyl]pyrimidine |
|---|---|
| PubChem CID | 11133121 |
| Molecular Formula | C16H9Cl3N2S2 |
| Molecular Weight | 399.76 g/mol |
| Exact Mass | 397.93 |
| IUPAC Name | 2-chloro-4,6-bis[(4-chlorophenyl)sulfanyl]pyrimidine |
| SMILES | Clc1ccc(Sc2cc(Sc3ccc(Cl)cc3)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C16H9Cl3N2S2/c17-10-1-5-12(6-2-10)22-14-9-15(21-16(19)20-14)23-13-7-3-11(18)4-8-13/h1-9H |
| InChIKey | TUBDAAOHEDBOSV-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.76 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |