C14H17F3N2O3 — CID 111331375
N-[(1-hydroxycyclopentyl)methyl]-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 111331375) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.29 g/mol. Its IUPAC name is N-[(1-hydroxycyclopentyl)methyl]-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-[(1-hydroxycyclopentyl)methyl]-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 111331375 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[(1-hydroxycyclopentyl)methyl]-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | O=C(Cn1cccc(C(F)(F)F)c1=O)NCC1(O)CCCC1 |
| InChI | InChI=1S/C14H17F3N2O3/c15-14(16,17)10-4-3-7-19(12(10)21)8-11(20)18-9-13(22)5-1-2-6-13/h3-4,7,22H,1-2,5-6,8-9H2,(H,18,20) |
| InChIKey | CBVDQQPXZATSQU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |