C23H31F2N3O3 — CID 111336001
1-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-(3-ethoxypropyl)-2-[(4-methoxyphenyl)methyl]guanidine (PubChem CID 111336001) has the molecular formula C23H31F2N3O3 and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-(3-ethoxypropyl)-2-[(4-methoxyphenyl)methyl]guanidine.
| Compound Name | 1-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-(3-ethoxypropyl)-2-[(4-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111336001 |
| Molecular Formula | C23H31F2N3O3 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-(3-ethoxypropyl)-2-[(4-methoxyphenyl)methyl]guanidine |
| SMILES | CCOCCCN/C(=N\Cc1ccc(OC)cc1)NCC(C)(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H31F2N3O3/c1-4-31-13-5-12-26-22(27-15-17-6-9-19(30-3)10-7-17)28-16-23(2,29)20-11-8-18(24)14-21(20)25/h6-11,14,29H,4-5,12-13,15-16H2,1-3H3,(H2,26,27,28) |
| InChIKey | QVOVYYRTFZMEBK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|