C24H31N5O2 — CID 11133602
N-[5-[4-(2-methoxyphenyl)piperazin-1-yl]pentyl]pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 11133602) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is N-[5-[4-(2-methoxyphenyl)piperazin-1-yl]pentyl]pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-[5-[4-(2-methoxyphenyl)piperazin-1-yl]pentyl]pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11133602 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | N-[5-[4-(2-methoxyphenyl)piperazin-1-yl]pentyl]pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | COc1ccccc1N1CCN(CCCCCNC(=O)c2cnn3ccccc23)CC1 |
| InChI | InChI=1S/C24H31N5O2/c1-31-23-11-4-3-10-22(23)28-17-15-27(16-18-28)13-7-2-6-12-25-24(30)20-19-26-29-14-8-5-9-21(20)29/h3-5,8-11,14,19H,2,6-7,12-13,15-18H2,1H3,(H,25,30) |
| InChIKey | KQJHXQUMRFPEBH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|