C23H28N4O3 — CID 25072941
6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-3-carbaldehyde (PubChem CID 25072941) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-3-carbaldehyde.
| Compound Name | 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 25072941 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-3-carbaldehyde |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccc3c(C=O)cnn3c2)CC1 |
| InChI | InChI=1S/C23H28N4O3/c1-29-23-7-3-2-6-22(23)26-13-11-25(12-14-26)10-4-5-15-30-20-8-9-21-19(18-28)16-24-27(21)17-20/h2-3,6-9,16-18H,4-5,10-15H2,1H3 |
| InChIKey | ZYJQELHTQSMKFH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|