C23H27N5O2 — CID 25072002
5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 25072002) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 25072002 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccn3ncc(C#N)c3c2)CC1 |
| InChI | InChI=1S/C23H27N5O2/c1-29-23-7-3-2-6-21(23)27-13-11-26(12-14-27)9-4-5-15-30-20-8-10-28-22(16-20)19(17-24)18-25-28/h2-3,6-8,10,16,18H,4-5,9,11-15H2,1H3 |
| InChIKey | JMDXHUNKNDOMJU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|