C16H21N3O3 — CID 111336603
4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazol-4-yl]methylamino]butan-2-ol (PubChem CID 111336603) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazol-4-yl]methylamino]butan-2-ol.
| Compound Name | 4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazol-4-yl]methylamino]butan-2-ol |
|---|---|
| PubChem CID | 111336603 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 4-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazol-4-yl]methylamino]butan-2-ol |
| SMILES | CC(O)CCNCc1cn[nH]c1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H21N3O3/c1-11(20)4-5-17-9-13-10-18-19-16(13)12-2-3-14-15(8-12)22-7-6-21-14/h2-3,8,10-11,17,20H,4-7,9H2,1H3,(H,18,19) |
| InChIKey | HFGJWHFSEKLPLD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|