C20H20FN3O3 — CID 47052274
N-[[5-(1,3-benzodioxol-5-yl)-1H-pyrazol-4-yl]methyl]-3-(2-fluorophenoxy)propan-1-amine (PubChem CID 47052274) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is N-[[5-(1,3-benzodioxol-5-yl)-1H-pyrazol-4-yl]methyl]-3-(2-fluorophenoxy)propan-1-amine.
| Compound Name | N-[[5-(1,3-benzodioxol-5-yl)-1H-pyrazol-4-yl]methyl]-3-(2-fluorophenoxy)propan-1-amine |
|---|---|
| PubChem CID | 47052274 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[[5-(1,3-benzodioxol-5-yl)-1H-pyrazol-4-yl]methyl]-3-(2-fluorophenoxy)propan-1-amine |
| SMILES | Fc1ccccc1OCCCNCc1cn[nH]c1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H20FN3O3/c21-16-4-1-2-5-17(16)25-9-3-8-22-11-15-12-23-24-20(15)14-6-7-18-19(10-14)27-13-26-18/h1-2,4-7,10,12,22H,3,8-9,11,13H2,(H,23,24) |
| InChIKey | FLIBAMGUQTYLPC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|