C13H15F2N3O — CID 79485108
N-[[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]methyl]-2-methoxyethanamine (PubChem CID 79485108) has the molecular formula C13H15F2N3O and a molecular weight of 267.28 g/mol. Its IUPAC name is N-[[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 79485108 |
| Molecular Formula | C13H15F2N3O |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-[[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cn[nH]c1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H15F2N3O/c1-19-5-4-16-7-10-8-17-18-13(10)9-2-3-11(14)12(15)6-9/h2-3,6,8,16H,4-5,7H2,1H3,(H,17,18) |
| InChIKey | ISDRBDORGJRAPT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|