C20H22FNO2 — CID 111337686
1-(4-fluorophenyl)-N-(2-hydroxy-2-phenylpropyl)cyclobutane-1-carboxamide (PubChem CID 111337686) has the molecular formula C20H22FNO2 and a molecular weight of 327.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(2-hydroxy-2-phenylpropyl)cyclobutane-1-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(2-hydroxy-2-phenylpropyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 111337686 |
| Molecular Formula | C20H22FNO2 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(2-hydroxy-2-phenylpropyl)cyclobutane-1-carboxamide |
| SMILES | CC(O)(CNC(=O)C1(c2ccc(F)cc2)CCC1)c1ccccc1 |
| InChI | InChI=1S/C20H22FNO2/c1-19(24,15-6-3-2-4-7-15)14-22-18(23)20(12-5-13-20)16-8-10-17(21)11-9-16/h2-4,6-11,24H,5,12-14H2,1H3,(H,22,23) |
| InChIKey | QPEUEZRIOWIZPN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |