C24H33IN4O3 — CID 111339198
N-[3-[[[ethylamino-[2-(2-methoxyphenyl)ethylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide (PubChem CID 111339198) has the molecular formula C24H33IN4O3 and a molecular weight of 552.46 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[2-(2-methoxyphenyl)ethylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[2-(2-methoxyphenyl)ethylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111339198 |
| Molecular Formula | C24H33IN4O3 |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | N-[3-[[[ethylamino-[2-(2-methoxyphenyl)ethylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCCO2)c1)NCCc1ccccc1OC.I |
| InChI | InChI=1S/C24H32N4O3.HI/c1-3-25-24(26-14-13-19-9-4-5-11-21(19)30-2)27-17-18-8-6-10-20(16-18)28-23(29)22-12-7-15-31-22;/h4-6,8-11,16,22H,3,7,12-15,17H2,1-2H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | OOTSGLJYNBXHAF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|