C16H26IN3OS — CID 111340154
1-[2-(2-methoxyphenyl)ethyl]-2-methyl-3-(2-prop-2-enylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111340154) has the molecular formula C16H26IN3OS and a molecular weight of 435.38 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)ethyl]-2-methyl-3-(2-prop-2-enylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2-methoxyphenyl)ethyl]-2-methyl-3-(2-prop-2-enylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111340154 |
| Molecular Formula | C16H26IN3OS |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)ethyl]-2-methyl-3-(2-prop-2-enylsulfanylethyl)guanidine;hydroiodide |
| SMILES | C=CCSCCN/C(=N\C)NCCc1ccccc1OC.I |
| InChI | InChI=1S/C16H25N3OS.HI/c1-4-12-21-13-11-19-16(17-2)18-10-9-14-7-5-6-8-15(14)20-3;/h4-8H,1,9-13H2,2-3H3,(H2,17,18,19);1H |
| InChIKey | CBVWYPXZCLNTTC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|