C25H34IN5O — CID 111341380
1-ethyl-3-(3-indol-1-ylpropyl)-2-[(2-morpholin-4-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111341380) has the molecular formula C25H34IN5O and a molecular weight of 547.49 g/mol. Its IUPAC name is 1-ethyl-3-(3-indol-1-ylpropyl)-2-[(2-morpholin-4-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-indol-1-ylpropyl)-2-[(2-morpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111341380 |
| Molecular Formula | C25H34IN5O |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 1-ethyl-3-(3-indol-1-ylpropyl)-2-[(2-morpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1N1CCOCC1)NCCCn1ccc2ccccc21.I |
| InChI | InChI=1S/C25H33N5O.HI/c1-2-26-25(27-13-7-14-29-15-12-21-8-3-5-10-23(21)29)28-20-22-9-4-6-11-24(22)30-16-18-31-19-17-30;/h3-6,8-12,15H,2,7,13-14,16-20H2,1H3,(H2,26,27,28);1H |
| InChIKey | DUYCWJSVJQATON-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|