C20H28IN5O — CID 111785280
1-ethyl-2-[(3-ethyl-1,2-oxazol-5-yl)methyl]-3-(3-indol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111785280) has the molecular formula C20H28IN5O and a molecular weight of 481.38 g/mol. Its IUPAC name is 1-ethyl-2-[(3-ethyl-1,2-oxazol-5-yl)methyl]-3-(3-indol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-ethyl-1,2-oxazol-5-yl)methyl]-3-(3-indol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111785280 |
| Molecular Formula | C20H28IN5O |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 1-ethyl-2-[(3-ethyl-1,2-oxazol-5-yl)methyl]-3-(3-indol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(CC)no1)NCCCn1ccc2ccccc21.I |
| InChI | InChI=1S/C20H27N5O.HI/c1-3-17-14-18(26-24-17)15-23-20(21-4-2)22-11-7-12-25-13-10-16-8-5-6-9-19(16)25;/h5-6,8-10,13-14H,3-4,7,11-12,15H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | GZTIMZXTZQMADN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 67.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|