C16H27N3OS — CID 111343965
2-methyl-1-[[2-(2-methylpropoxy)phenyl]methyl]-3-(2-methylsulfanylethyl)guanidine (PubChem CID 111343965) has the molecular formula C16H27N3OS and a molecular weight of 309.48 g/mol. Its IUPAC name is 2-methyl-1-[[2-(2-methylpropoxy)phenyl]methyl]-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 2-methyl-1-[[2-(2-methylpropoxy)phenyl]methyl]-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111343965 |
| Molecular Formula | C16H27N3OS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-methyl-1-[[2-(2-methylpropoxy)phenyl]methyl]-3-(2-methylsulfanylethyl)guanidine |
| SMILES | C/N=C(\NCCSC)NCc1ccccc1OCC(C)C |
| InChI | InChI=1S/C16H27N3OS/c1-13(2)12-20-15-8-6-5-7-14(15)11-19-16(17-3)18-9-10-21-4/h5-8,13H,9-12H2,1-4H3,(H2,17,18,19) |
| InChIKey | JTALXFHOPULALV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|