C18H31N3OS — CID 111627978
2-methyl-1-[[2-(2-methylpropoxy)phenyl]methyl]-3-(4-methylsulfanylbutyl)guanidine (PubChem CID 111627978) has the molecular formula C18H31N3OS and a molecular weight of 337.53 g/mol. Its IUPAC name is 2-methyl-1-[[2-(2-methylpropoxy)phenyl]methyl]-3-(4-methylsulfanylbutyl)guanidine.
| Compound Name | 2-methyl-1-[[2-(2-methylpropoxy)phenyl]methyl]-3-(4-methylsulfanylbutyl)guanidine |
|---|---|
| PubChem CID | 111627978 |
| Molecular Formula | C18H31N3OS |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 2-methyl-1-[[2-(2-methylpropoxy)phenyl]methyl]-3-(4-methylsulfanylbutyl)guanidine |
| SMILES | C/N=C(\NCCCCSC)NCc1ccccc1OCC(C)C |
| InChI | InChI=1S/C18H31N3OS/c1-15(2)14-22-17-10-6-5-9-16(17)13-21-18(19-3)20-11-7-8-12-23-4/h5-6,9-10,15H,7-8,11-14H2,1-4H3,(H2,19,20,21) |
| InChIKey | CKZOOYPECSWQLR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|