C22H31N3OS — CID 111627168
2-methyl-1-(4-methylsulfanylbutyl)-3-[[2-(phenylmethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111627168) has the molecular formula C22H31N3OS and a molecular weight of 385.58 g/mol. Its IUPAC name is 2-methyl-1-(4-methylsulfanylbutyl)-3-[[2-(phenylmethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-(4-methylsulfanylbutyl)-3-[[2-(phenylmethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111627168 |
| Molecular Formula | C22H31N3OS |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2-methyl-1-(4-methylsulfanylbutyl)-3-[[2-(phenylmethoxymethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCCCSC)NCc1ccccc1COCc1ccccc1 |
| InChI | InChI=1S/C22H31N3OS/c1-23-22(24-14-8-9-15-27-2)25-16-20-12-6-7-13-21(20)18-26-17-19-10-4-3-5-11-19/h3-7,10-13H,8-9,14-18H2,1-2H3,(H2,23,24,25) |
| InChIKey | MYERKOAARAYFKX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|