C14H22BrIN4OS — CID 111344180
N-(4-bromophenyl)-3-[[N'-methyl-N-(2-methylsulfanylethyl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111344180) has the molecular formula C14H22BrIN4OS and a molecular weight of 501.23 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-[[N'-methyl-N-(2-methylsulfanylethyl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(4-bromophenyl)-3-[[N'-methyl-N-(2-methylsulfanylethyl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111344180 |
| Molecular Formula | C14H22BrIN4OS |
| Molecular Weight | 501.23 g/mol |
| Exact Mass | 499.97 |
| IUPAC Name | N-(4-bromophenyl)-3-[[N'-methyl-N-(2-methylsulfanylethyl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCSC)NCCC(=O)Nc1ccc(Br)cc1.I |
| InChI | InChI=1S/C14H21BrN4OS.HI/c1-16-14(18-9-10-21-2)17-8-7-13(20)19-12-5-3-11(15)4-6-12;/h3-6H,7-10H2,1-2H3,(H,19,20)(H2,16,17,18);1H |
| InChIKey | FRHLQVTUDSXAMC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|