C15H21BrN4O — CID 111869112
N-(4-bromophenyl)-3-[[N-(cyclopropylmethyl)-N'-methylcarbamimidoyl]amino]propanamide (PubChem CID 111869112) has the molecular formula C15H21BrN4O and a molecular weight of 353.26 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-[[N-(cyclopropylmethyl)-N'-methylcarbamimidoyl]amino]propanamide.
| Compound Name | N-(4-bromophenyl)-3-[[N-(cyclopropylmethyl)-N'-methylcarbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111869112 |
| Molecular Formula | C15H21BrN4O |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-(4-bromophenyl)-3-[[N-(cyclopropylmethyl)-N'-methylcarbamimidoyl]amino]propanamide |
| SMILES | C/N=C(/NCCC(=O)Nc1ccc(Br)cc1)NCC1CC1 |
| InChI | InChI=1S/C15H21BrN4O/c1-17-15(19-10-11-2-3-11)18-9-8-14(21)20-13-6-4-12(16)5-7-13/h4-7,11H,2-3,8-10H2,1H3,(H,20,21)(H2,17,18,19) |
| InChIKey | ZUOHMVMEDIHDEO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|