C17H29F2IN6O — CID 111348049
2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111348049) has the molecular formula C17H29F2IN6O and a molecular weight of 498.36 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111348049 |
| Molecular Formula | C17H29F2IN6O |
| Molecular Weight | 498.36 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)NCCCN1CCCCCC1=O.I |
| InChI | InChI=1S/C17H28F2N6O.HI/c1-2-20-17(23-13-14-21-9-12-25(14)16(18)19)22-8-6-11-24-10-5-3-4-7-15(24)26;/h9,12,16H,2-8,10-11,13H2,1H3,(H2,20,22,23);1H |
| InChIKey | LUOLPFBFCNABJO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|