C31H33N3O3 — CID 11134808
5-hexoxy-3-N-[(1R)-1-naphthalen-2-ylethyl]-1-N-pyridin-2-ylbenzene-1,3-dicarboxamide (PubChem CID 11134808) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is 5-hexoxy-3-N-[(1R)-1-naphthalen-2-ylethyl]-1-N-pyridin-2-ylbenzene-1,3-dicarboxamide.
| Compound Name | 5-hexoxy-3-N-[(1R)-1-naphthalen-2-ylethyl]-1-N-pyridin-2-ylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 11134808 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 5-hexoxy-3-N-[(1R)-1-naphthalen-2-ylethyl]-1-N-pyridin-2-ylbenzene-1,3-dicarboxamide |
| SMILES | CCCCCCOc1cc(C(=O)Nc2ccccn2)cc(C(=O)N[C@H](C)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C31H33N3O3/c1-3-4-5-10-17-37-28-20-26(19-27(21-28)31(36)34-29-13-8-9-16-32-29)30(35)33-22(2)24-15-14-23-11-6-7-12-25(23)18-24/h6-9,11-16,18-22H,3-5,10,17H2,1-2H3,(H,33,35)(H,32,34,36)/t22-/m1/s1 |
| InChIKey | GPDLZXHFHNTQNN-JOCHJYFZSA-N |
| XLogP | 6.94 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|