C43H51N3O4 — CID 146672049
2-N,6-N-bis[(1R)-1-(6-hexoxynaphthalen-2-yl)ethyl]pyridine-2,6-dicarboxamide (PubChem CID 146672049) has the molecular formula C43H51N3O4 and a molecular weight of 673.90 g/mol. Its IUPAC name is 2-N,6-N-bis[(1R)-1-(6-hexoxynaphthalen-2-yl)ethyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[(1R)-1-(6-hexoxynaphthalen-2-yl)ethyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 146672049 |
| Molecular Formula | C43H51N3O4 |
| Molecular Weight | 673.90 g/mol |
| Exact Mass | 673.39 |
| IUPAC Name | 2-N,6-N-bis[(1R)-1-(6-hexoxynaphthalen-2-yl)ethyl]pyridine-2,6-dicarboxamide |
| SMILES | CCCCCCOc1ccc2cc([C@@H](C)NC(=O)c3cccc(C(=O)N[C@H](C)c4ccc5cc(OCCCCCC)ccc5c4)n3)ccc2c1 |
| InChI | InChI=1S/C43H51N3O4/c1-5-7-9-11-24-49-38-22-20-34-26-32(16-18-36(34)28-38)30(3)44-42(47)40-14-13-15-41(46-40)43(48)45-31(4)33-17-19-37-29-39(23-21-35(37)27-33)50-25-12-10-8-6-2/h13-23,26-31H,5-12,24-25H2,1-4H3,(H,44,47)(H,45,48)/t30-,31-/m1/s1 |
| InChIKey | QWCHUNVQEUOWGB-FIRIVFDPSA-N |
| XLogP | 10.29 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.90 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|