C32H37N3O2 — CID 11134810
N-cyclopropyl-3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-phenylbenzamide (PubChem CID 11134810) has the molecular formula C32H37N3O2 and a molecular weight of 495.67 g/mol. Its IUPAC name is N-cyclopropyl-3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-phenylbenzamide.
| Compound Name | N-cyclopropyl-3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 11134810 |
| Molecular Formula | C32H37N3O2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | N-cyclopropyl-3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-phenylbenzamide |
| SMILES | C=CCN1C[C@H](C)N([C@@H](c2cccc(O)c2)c2cccc(C(=O)N(c3ccccc3)C3CC3)c2)C[C@H]1C |
| InChI | InChI=1S/C32H37N3O2/c1-4-18-33-21-24(3)34(22-23(33)2)31(26-11-9-15-30(36)20-26)25-10-8-12-27(19-25)32(37)35(29-16-17-29)28-13-6-5-7-14-28/h4-15,19-20,23-24,29,31,36H,1,16-18,21-22H2,2-3H3/t23-,24+,31-/m1/s1 |
| InChIKey | QJIRJFCKPGNFTF-ULPIOCOXSA-N |
| XLogP | 5.87 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|