C24H34N6S — CID 111352168
2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111352168) has the molecular formula C24H34N6S and a molecular weight of 438.65 g/mol. Its IUPAC name is 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111352168 |
| Molecular Formula | C24H34N6S |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine |
| SMILES | C/N=C(/NCCCn1c(C)nc2ccccc21)NCC1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C24H34N6S/c1-19-28-22-8-3-4-9-23(22)30(19)13-6-12-26-24(25-2)27-17-20-10-14-29(15-11-20)18-21-7-5-16-31-21/h3-5,7-9,16,20H,6,10-15,17-18H2,1-2H3,(H2,25,26,27) |
| InChIKey | ZYZOHKZHWFAAGX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|