C26H40IN5 — CID 111356841
1-(2,2-diphenylethyl)-3-ethyl-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111356841) has the molecular formula C26H40IN5 and a molecular weight of 549.55 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-3-ethyl-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(2,2-diphenylethyl)-3-ethyl-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111356841 |
| Molecular Formula | C26H40IN5 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | 1-(2,2-diphenylethyl)-3-ethyl-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)CN1CCN(C)CC1)NCC(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C26H39N5.HI/c1-4-27-26(28-19-22(2)21-31-17-15-30(3)16-18-31)29-20-25(23-11-7-5-8-12-23)24-13-9-6-10-14-24;/h5-14,22,25H,4,15-21H2,1-3H3,(H2,27,28,29);1H |
| InChIKey | QUBWJIAUSIGJQU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|