C16H35IN6O — CID 111363830
2-[[ethylamino-[2-(4-ethylpiperazin-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111363830) has the molecular formula C16H35IN6O and a molecular weight of 454.40 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(4-ethylpiperazin-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[2-(4-ethylpiperazin-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111363830 |
| Molecular Formula | C16H35IN6O |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 2-[[ethylamino-[2-(4-ethylpiperazin-1-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)NCC(C)N1CCN(CC)CC1.I |
| InChI | InChI=1S/C16H34N6O.HI/c1-6-17-16(19-13-15(23)20(4)5)18-12-14(3)22-10-8-21(7-2)9-11-22;/h14H,6-13H2,1-5H3,(H2,17,18,19);1H |
| InChIKey | BTHOZLGOYPXFDH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|