C16H32IN5O — CID 111364098
N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-(2-piperidin-1-ylethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111364098) has the molecular formula C16H32IN5O and a molecular weight of 437.37 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-(2-piperidin-1-ylethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-(2-piperidin-1-ylethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111364098 |
| Molecular Formula | C16H32IN5O |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-(2-piperidin-1-ylethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)NCCN1CCCCC1.I |
| InChI | InChI=1S/C16H31N5O.HI/c1-14(2)12-18-16(19-13-15(22)20(3)4)17-8-11-21-9-6-5-7-10-21;/h1,5-13H2,2-4H3,(H2,17,18,19);1H |
| InChIKey | YPZJPVNKNGLAHK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|