C20H26N4O2S — CID 111372663
N-[2-[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]ethyl]-4-hydroxybenzamide (PubChem CID 111372663) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[2-[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]ethyl]-4-hydroxybenzamide.
| Compound Name | N-[2-[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]ethyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 111372663 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[2-[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]ethyl]-4-hydroxybenzamide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccc(O)cc1)NCCSc1ccccc1 |
| InChI | InChI=1S/C20H26N4O2S/c1-2-21-20(24-14-15-27-18-6-4-3-5-7-18)23-13-12-22-19(26)16-8-10-17(25)11-9-16/h3-11,25H,2,12-15H2,1H3,(H,22,26)(H2,21,23,24) |
| InChIKey | RTKKHAXAWLJWKN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|