C17H29IN4OS — CID 111372688
3-[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]-N-propan-2-ylpropanamide;hydroiodide (PubChem CID 111372688) has the molecular formula C17H29IN4OS and a molecular weight of 464.42 g/mol. Its IUPAC name is 3-[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]-N-propan-2-ylpropanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]-N-propan-2-ylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111372688 |
| Molecular Formula | C17H29IN4OS |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3-[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]-N-propan-2-ylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)NC(C)C)NCCSc1ccccc1.I |
| InChI | InChI=1S/C17H28N4OS.HI/c1-4-18-17(19-11-10-16(22)21-14(2)3)20-12-13-23-15-8-6-5-7-9-15;/h5-9,14H,4,10-13H2,1-3H3,(H,21,22)(H2,18,19,20);1H |
| InChIKey | NVYBKGPPOXGRNU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|