C12H27IN4OS — CID 111344168
3-[[N-ethyl-N'-(2-methylsulfanylethyl)carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide (PubChem CID 111344168) has the molecular formula C12H27IN4OS and a molecular weight of 402.35 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-(2-methylsulfanylethyl)carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide.
| Compound Name | 3-[[N-ethyl-N'-(2-methylsulfanylethyl)carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111344168 |
| Molecular Formula | C12H27IN4OS |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 3-[[N-ethyl-N'-(2-methylsulfanylethyl)carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCSC)NCCC(=O)NC(C)C.I |
| InChI | InChI=1S/C12H26N4OS.HI/c1-5-13-12(15-8-9-18-4)14-7-6-11(17)16-10(2)3;/h10H,5-9H2,1-4H3,(H,16,17)(H2,13,14,15);1H |
| InChIKey | LZHZGYSCCGSABH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|