C21H26N6S — CID 111373213
1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine (PubChem CID 111373213) has the molecular formula C21H26N6S and a molecular weight of 394.55 g/mol. Its IUPAC name is 1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine.
| Compound Name | 1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111373213 |
| Molecular Formula | C21H26N6S |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine |
| SMILES | C/N=C(\NCCSc1ccccc1)NCc1ccc(-n2nc(C)cc2C)nc1 |
| InChI | InChI=1S/C21H26N6S/c1-16-13-17(2)27(26-16)20-10-9-18(14-24-20)15-25-21(22-3)23-11-12-28-19-7-5-4-6-8-19/h4-10,13-14H,11-12,15H2,1-3H3,(H2,22,23,25) |
| InChIKey | HRZRCMHARZONQW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|