C19H25N7S — CID 111932528
1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111932528) has the molecular formula C19H25N7S and a molecular weight of 383.53 g/mol. Its IUPAC name is 1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111932528 |
| Molecular Formula | C19H25N7S |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1csc(C)n1)NCc1ccc(-n2nc(C)cc2C)nc1 |
| InChI | InChI=1S/C19H25N7S/c1-13-9-14(2)26(25-13)18-6-5-16(10-22-18)11-23-19(20-4)21-8-7-17-12-27-15(3)24-17/h5-6,9-10,12H,7-8,11H2,1-4H3,(H2,20,21,23) |
| InChIKey | KQLNYMZUMZRVMZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|