C20H30N4O3S — CID 111376536
2-methyl-1-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111376536) has the molecular formula C20H30N4O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111376536 |
| Molecular Formula | C20H30N4O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-methyl-1-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCCc1csc(C(C)C)n1)NCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H30N4O3S/c1-13(2)19-24-15(12-28-19)7-8-22-20(21-3)23-11-14-9-16(25-4)18(27-6)17(10-14)26-5/h9-10,12-13H,7-8,11H2,1-6H3,(H2,21,22,23) |
| InChIKey | WLWCYYGPJMBTEY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|