C20H28N4O5S — CID 111377475
2-methyl-1-[[4-(methylsulfamoyl)phenyl]methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111377475) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-methyl-1-[[4-(methylsulfamoyl)phenyl]methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[[4-(methylsulfamoyl)phenyl]methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111377475 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-methyl-1-[[4-(methylsulfamoyl)phenyl]methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)NC)cc1)NCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H28N4O5S/c1-21-20(23-12-14-6-8-16(9-7-14)30(25,26)22-2)24-13-15-10-17(27-3)19(29-5)18(11-15)28-4/h6-11,22H,12-13H2,1-5H3,(H2,21,23,24) |
| InChIKey | BTJMJLTVCUAAQP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|